|
|
| (3 intermediate revisions by the same user not shown) |
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Gene]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7257 CPD-7257] == | + | == Gene Tiso_gene_4808 == |
| − | * smiles:
| + | |
| − | ** CC(CCC(=O)C(C)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)[CH]4(CC[CH]5(C(C)4C(O)C[CH]6([CH]5C(O)C[CH]7(C(C)6CCC(O)C7))))
| + | |
| − | * inchi key:
| + | |
| − | ** InChIKey=AWLXQJGPNLCTLM-YFXOTMPNSA-J
| + | |
| − | * common name:
| + | |
| − | ** 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl CoA
| + | |
| − | * molecular weight:
| + | |
| − | ** 1210.128
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** 3-α,7-α,12-α-trihydroxy-24-oxo-5-β-cholestanoyl CoA
| |
| − | ** 3alpha,7alpha,12alpha-trihydroxy-24-oxo-5beta-cholestanoyl-CoA
| |
| − | ** 3alpha,7alpha,12alpha-trihydroxy-5beta-24-oxocholestanoyl-CoA
| |
| − | ** 3α,7α,12α-trihydroxy-5β-cholest-24-one-CoA
| |
| − | ** 24-keto,(25R)-trihydroxycholestanoyl-CoA
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reactions associated == |
| − | * [[2.3.1.176-RXN]] | + | * Reaction: [[LPLPS1AGPE180]] |
| − | == Reaction(s) known to produce the compound == | + | ** Source: [[orthology-creinhardtii]] |
| − | == Reaction(s) of unknown directionality ==
| + | == Pathways associated == |
| | == External links == | | == External links == |
| − | * PUBCHEM:
| + | {{#set: reaction associated=LPLPS1AGPE180}} |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266665 45266665]
| + | |
| − | * CHEBI:
| + | |
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58507 58507]
| + | |
| − | * LIGAND-CPD:
| + | |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?C05467 C05467]
| + | |
| − | * HMDB : HMDB06891
| + | |
| − | {{#set: smiles=CC(CCC(=O)C(C)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)[CH]4(CC[CH]5(C(C)4C(O)C[CH]6([CH]5C(O)C[CH]7(C(C)6CCC(O)C7))))}}
| + | |
| − | {{#set: inchi key=InChIKey=AWLXQJGPNLCTLM-YFXOTMPNSA-J}}
| + | |
| − | {{#set: common name=3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl CoA}}
| + | |
| − | {{#set: molecular weight=1210.128 }}
| + | |
| − | {{#set: common name=3-α,7-α,12-α-trihydroxy-24-oxo-5-β-cholestanoyl CoA|3alpha,7alpha,12alpha-trihydroxy-24-oxo-5beta-cholestanoyl-CoA|3alpha,7alpha,12alpha-trihydroxy-5beta-24-oxocholestanoyl-CoA|3α,7α,12α-trihydroxy-5β-cholest-24-one-CoA|24-keto,(25R)-trihydroxycholestanoyl-CoA}}
| + | |
| − | {{#set: consumed by=2.3.1.176-RXN}} | + | |
