Difference between revisions of "TRNA-Arg-inosine34"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Arg-inosine34 tRNA-Arg-inosine34] == * common name: ** an inosine34 in [tRNAArg2] * Synony...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Arg-inosine34 tRNA-Arg-inosine34] ==
−
* smiles:
+
−
** C(CC(=O)C(=O)[O-])CC(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 2-oxoadipate
+
** an inosine34 in [tRNAArg2]
−
* molecular weight:
+
−
** 158.11   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-ketoadipate
+
** [tRNAArg2]-inosine34
−
** α-ketoadipate
+
−
** 2-keto-adipate
+
−
** 2-oxohexanedionic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-1081]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 3184-35-8
+
{{#set: common name=an inosine34 in [tRNAArg2]}}
−
* PUBCHEM:
+
{{#set: common name=[tRNAArg2]-inosine34}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615192 23615192]
+
{{#set: produced by=RXN0-1081}}
−
* HMDB : HMDB00225
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00322 C00322]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19951093.html 19951093]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57499 57499]
+
−
* METABOLIGHTS : MTBLC57499
+
−
{{#set: smiles=C(CC(=O)C(=O)[O-])CC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L}}
+
−
{{#set: common name=2-oxoadipate}}
+
−
{{#set: molecular weight=158.11    }}
+
−
{{#set: common name=2-ketoadipate|α-ketoadipate|2-keto-adipate|2-oxohexanedionic acid}}
+
−
{{#set: consumed by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+
−
{{#set: consumed or produced by=2-AMINOADIPATE-AMINOTRANSFERASE-RXN}}
+

Latest revision as of 19:12, 21 March 2018

Metabolite tRNA-Arg-inosine34

  • common name:
    • an inosine34 in [tRNAArg2]
  • Synonym(s):
    • [tRNAArg2]-inosine34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an inosine34 in [tRNAArg2" cannot be used as a page name in this wiki.
"tRNAArg2]-inosine34" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-Arg-inosine34&oldid=40111"