Difference between revisions of "CPD-7137"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10015 == * left end position: ** 5829 * transcription direction: ** NEGATIVE * right end position: ** 6470 * centisome position: ** 65.4502...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O) |
− | * | + | * common name: |
− | ** | + | ** pelargonidin-3,5-di-O-β-D-glucoside |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 594.525 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7828]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643] |
− | {{#set: | + | * HMDB : HMDB33681 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725] | ||
+ | {{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}} | ||
+ | {{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}} | ||
+ | {{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}} | ||
+ | {{#set: molecular weight=594.525 }} | ||
+ | {{#set: produced by=RXN-7828}} |
Latest revision as of 21:19, 21 March 2018
Contents
Metabolite CPD-7137
- smiles:
- C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
- common name:
- pelargonidin-3,5-di-O-β-D-glucoside
- inchi key:
- InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
- molecular weight:
- 594.525
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)" cannot be used as a page name in this wiki.