Difference between revisions of "R02984"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R02984 R02984] == * direction: ** REVERSIBLE * common name: ** R252 * Synonym(s): == Reaction Form...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R02984 R02984] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** R252 |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1.0 [[DTDP-D-GLUCOSE]][c] '''<=>''' 1.0 [[DTDP-D-GALACTOSE]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 dTDP-α-D-glucose[c] '''<=>''' 1.0 dTDP-α-D-galactose[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_15395]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=R252}} | |
− | + | {{#set: gene associated=Tiso_gene_15395}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-synechocystis}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:19, 21 March 2018
Contents
Reaction R02984
- direction:
- REVERSIBLE
- common name:
- R252
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 DTDP-D-GLUCOSE[c] <=> 1.0 DTDP-D-GALACTOSE[c]
- With common name(s):
- 1.0 dTDP-α-D-glucose[c] <=> 1.0 dTDP-α-D-galactose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15395
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis