Difference between revisions of "CPD-6994"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9530 RXN-9530] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-Δ2-decenoyl-[acp]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * co...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == |
− | * | + | * smiles: |
− | ** | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) |
* common name: | * common name: | ||
− | ** | + | ** (2S)-eriodictyol |
− | * | + | * inchi key: |
− | + | ** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M | |
− | ** | + | * molecular weight: |
− | + | ** 287.248 | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7775]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147] | |
− | + | * HMDB : HMDB05810 | |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412] | |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631] | |
− | {{#set: | + | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}} |
− | + | {{#set: common name=(2S)-eriodictyol}} | |
− | + | {{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}} | |
− | {{#set: | + | {{#set: molecular weight=287.248 }} |
− | {{#set: | + | {{#set: consumed by=RXN-7775}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:19, 21 March 2018
Contents
Metabolite CPD-6994
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
- common name:
- (2S)-eriodictyol
- inchi key:
- InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
- molecular weight:
- 287.248
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)" cannot be used as a page name in this wiki.