Difference between revisions of "CPD-12481"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenal 19-hydroxylase *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * common name: ** 7-methyl...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == |
− | * | + | * smiles: |
− | ** | + | ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) |
* common name: | * common name: | ||
− | ** | + | ** 7-methylurate |
+ | * inchi key: | ||
+ | ** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 182.138 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-methyluric acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11521]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160] |
− | * LIGAND- | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.chemspider.com/Chemical-Structure.62375.html 62375] |
− | {{#set: | + | * HMDB : HMDB11107 |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355] |
− | {{#set: | + | {{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}} |
− | {{#set: | + | {{#set: common name=7-methylurate}} |
+ | {{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=182.138 }} | ||
+ | {{#set: common name=7-methyluric acid}} | ||
+ | {{#set: produced by=RXN-11521}} |
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite CPD-12481
- smiles:
- CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
- common name:
- 7-methylurate
- inchi key:
- InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
- molecular weight:
- 182.138
- Synonym(s):
- 7-methyluric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links