Difference between revisions of "CPD-12481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenal 19-hydroxylase *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * common name: ** 7-methyl...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
 
* common name:
 
* common name:
−
** ent-kaurenal 19-hydroxylase
+
** 7-methylurate
 +
* inchi key:
 +
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 182.138   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-methyluric acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[ENT-KAUR-16-EN-19-AL]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD1F-132]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-11521]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 ent-kaurenal[c] '''=>''' 1 NADP+[c] '''+''' 1 ent-kaur-16-en-19-oate[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1547]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_8263]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
+
−
** '''6''' reactions found over '''15''' reactions in the full pathway
+
−
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10931 10931]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06293 R06293]
+
** [http://www.chemspider.com/Chemical-Structure.62375.html 62375]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB11107
−
{{#set: common name=ent-kaurenal 19-hydroxylase}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_1547|Tiso_gene_8263}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470]
−
{{#set: in pathway=PWY-5047|PWY-5034}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}}
−
{{#set: reconstruction source=athaliana}}
+
{{#set: common name=7-methylurate}}
 +
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=182.138    }}
 +
{{#set: common name=7-methyluric acid}}
 +
{{#set: produced by=RXN-11521}}

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-12481

  • smiles:
    • CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
  • common name:
    • 7-methylurate
  • inchi key:
    • InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
  • molecular weight:
    • 182.138
  • Synonym(s):
    • 7-methyluric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12481&oldid=47842"