Difference between revisions of "7-AMINOMETHYL-7-DEAZAGUANINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-5-ADP 3-5-ADP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)OP(=O)([O-])[O-]))O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == * smiles: ** C([N+])C2(C1(C(=O)NC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** preQ1 |
+ | * inchi key: | ||
+ | ** InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 180.189 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7-aminomethyl-7-deazaguanine |
− | ** | + | ** 7-aminomethyl-7-carbaguanine |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-1321]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202264 25202264] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58703 58703] |
− | + | {{#set: smiles=C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))}} | |
− | {{#set: smiles=C( | + | {{#set: common name=preQ1}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O}} |
− | {{#set: | + | {{#set: molecular weight=180.189 }} |
− | {{#set: molecular weight= | + | {{#set: common name=7-aminomethyl-7-deazaguanine|7-aminomethyl-7-carbaguanine}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN0-1321}} |
− | + | ||
− | + | ||
− | {{#set: consumed | + |
Latest revision as of 20:20, 21 March 2018
Contents
Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE
- smiles:
- C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))
- common name:
- preQ1
- inchi key:
- InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O
- molecular weight:
- 180.189
- Synonym(s):
- 7-aminomethyl-7-deazaguanine
- 7-aminomethyl-7-carbaguanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))" cannot be used as a page name in this wiki.