Difference between revisions of "Tiso gene 15094"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15094 == * right end position: ** 3947 * transcription direction: ** NEGATIVE * left end position: ** 3241 * centisome position: ** 61.8747...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] ==
+
== Gene Tiso_gene_15094 ==
−
* smiles:
+
* right end position:
−
** C([N+])COP([O-])(=O)OCC(O)CO[R]
+
** 3947
−
* common name:
+
* transcription direction:
−
** 1-alkyl-sn-glycero-3-phosphoethanolamine
+
** NEGATIVE
 +
* left end position:
 +
** 3241
 +
* centisome position:
 +
** 61.87476   
 
* Synonym(s):
 
* Synonym(s):
−
** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
 
−
** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
 
−
** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[6.3.2.25-RXN]]
−
* [[LPLPS1AGPE180]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=3947}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=3241}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244]
+
{{#set: centisome position=61.87476    }}
−
{{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}}
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
{{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: produced by=LPLPS1AGPE180}}
+

Latest revision as of 21:20, 21 March 2018

Gene Tiso_gene_15094

  • right end position:
    • 3947
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3241
  • centisome position:
    • 61.87476
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15094&oldid=47901"