Difference between revisions of "CPD-19205"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15328 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** pantograph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] *...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == |
| + | * smiles: | ||
| + | ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] | ||
| + | * common name: | ||
| + | ** L-4-hydroxyphenylglycine-L-arginine | ||
| + | * inchi key: | ||
| + | ** InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O | ||
| + | * molecular weight: | ||
| + | ** 324.359 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-pHPG-L-Arg | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-17832]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]}} |
| + | {{#set: common name=L-4-hydroxyphenylglycine-L-arginine}} | ||
| + | {{#set: inchi key=InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O}} | ||
| + | {{#set: molecular weight=324.359 }} | ||
| + | {{#set: common name=L-pHPG-L-Arg}} | ||
| + | {{#set: produced by=RXN-17832}} | ||
Latest revision as of 21:20, 21 March 2018
Contents
Metabolite CPD-19205
- smiles:
- C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]
- common name:
- L-4-hydroxyphenylglycine-L-arginine
- inchi key:
- InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O
- molecular weight:
- 324.359
- Synonym(s):
- L-pHPG-L-Arg
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-" cannot be used as a page name in this wiki.
