Difference between revisions of "RXN-9660"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] == * smiles: ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9660 RXN-9660] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-Δ2-decenoyl-[acp]...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9660 RXN-9660] ==
−
* smiles:
+
* direction:
−
** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J
+
 
* common name:
 
* common name:
−
** 1-(5-phospho-β-D-ribosyl)-AMP
+
** trans-Δ2-decenoyl-[acp]-reductase
−
* molecular weight:
+
* ec number:
−
** 555.288   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** 1-(5-phosphoribosyl)-AMP
 
−
** phosphoribosyl-AMP
 
−
** 5-phosphoribosyl-AMP
 
−
** N-(5-phospho-D-ribosyl)-AMP
 
−
** N-(5'-phospho-D-ribosyl)-AMP
 
−
** N1-(5-phospho-D-ribosyl)-AMP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[HISTCYCLOHYD-RXN]]
+
* With identifiers:
−
* [[PRACH]]
+
** 1 [[Trans-D2-decenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Decanoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[HISTPRATPHYD-RXN]]
+
** 1 a (2E)-dec-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 a decanoyl-[acp][c] '''+''' 1 NAD+[c]
−
* [[PRADP]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02741 C02741]
+
{{#set: common name=trans-Δ2-decenoyl-[acp]-reductase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59457 59457]
+
{{#set: gene associated=Tiso_gene_10778}}
−
* BIGG : prbamp
+
{{#set: in pathway=PWY-5971}}
−
* PUBCHEM:
+
{{#set: reconstruction category=orthology}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480652 45480652]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* HMDB : HMDB12276
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J}}
+
−
{{#set: common name=1-(5-phospho-β-D-ribosyl)-AMP}}
+
−
{{#set: molecular weight=555.288    }}
+
−
{{#set: common name=1-(5-phosphoribosyl)-AMP|phosphoribosyl-AMP|5-phosphoribosyl-AMP|N-(5-phospho-D-ribosyl)-AMP|N-(5'-phospho-D-ribosyl)-AMP|N1-(5-phospho-D-ribosyl)-AMP}}
+
−
{{#set: consumed by=HISTCYCLOHYD-RXN|PRACH}}
+
−
{{#set: produced by=HISTPRATPHYD-RXN|PRADP}}
+

Latest revision as of 20:20, 21 March 2018

Reaction RXN-9660

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-Δ2-decenoyl-[acp]-reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans-Δ2-decenoyl-[acp]-reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9660&oldid=47963"