Difference between revisions of "Aryl-sulfates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] == * smiles: ** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-sulfates Aryl-sulfates] == * common name: ** an aryl sulfate * Synonym(s): == Reaction(s)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-sulfates Aryl-sulfates] ==
* smiles:
+
** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)
+
* inchi key:
+
** InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K
+
 
* common name:
 
* common name:
** tetrahydromethanopterin
+
** an aryl sulfate
* molecular weight:
+
** 773.666   
+
 
* Synonym(s):
 
* Synonym(s):
** THMPT
 
** 5,6,7,8-tetrahydromethanopterin
 
** H4MPT
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15635]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ARYL-SULFOTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an aryl sulfate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791993 49791993]
+
{{#set: reversible reaction associated=ARYL-SULFOTRANSFERASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58103 58103]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01217 C01217]
+
* HMDB : HMDB60403
+
{{#set: smiles=CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)}}
+
{{#set: inchi key=InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K}}
+
{{#set: common name=tetrahydromethanopterin}}
+
{{#set: molecular weight=773.666    }}
+
{{#set: common name=THMPT|5,6,7,8-tetrahydromethanopterin|H4MPT}}
+
{{#set: produced by=RXN-15635}}
+

Latest revision as of 20:20, 21 March 2018

Metabolite Aryl-sulfates

  • common name:
    • an aryl sulfate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links