Difference between revisions of "CPDQT-37"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Light Light] == * common name: ** hν * Synonym(s): ** light ** a photon == Reaction(s) know...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * smiles: ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(4'-meth...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == |
| + | * smiles: | ||
| + | ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-(4'-methylthio)butylmalate |
| + | * inchi key: | ||
| + | ** InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L | ||
| + | * molecular weight: | ||
| + | ** 234.267 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-(4'-methylthio)butylmalic acid |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXNQT-4168]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-18206]] |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237164 44237164] |
| − | {{#set: | + | {{#set: smiles=CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=3-(4'-methylthio)butylmalate}} |
| − | {{#set: consumed | + | {{#set: inchi key=InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L}} |
| + | {{#set: molecular weight=234.267 }} | ||
| + | {{#set: common name=3-(4'-methylthio)butylmalic acid}} | ||
| + | {{#set: consumed by=RXNQT-4168}} | ||
| + | {{#set: reversible reaction associated=RXN-18206}} | ||
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite CPDQT-37
- smiles:
- CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-(4'-methylthio)butylmalate
- inchi key:
- InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L
- molecular weight:
- 234.267
- Synonym(s):
- 3-(4'-methylthio)butylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
