Difference between revisions of "AMCL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] == * smiles: ** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMCL AMCL] == * direction: ** LEFT-TO-RIGHT * common name: ** S-adenosyl-L-methionine carboxy-lyase...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMCL AMCL] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J
+
 
* common name:
 
* common name:
** (5Z)-dodecenoyl-CoA
+
** S-adenosyl-L-methionine carboxy-lyase
* molecular weight:
+
** 943.792   
+
 
* Synonym(s):
 
* Synonym(s):
** 12:1-Δ5-CoA
 
** cis-5-tetradecenoyl-CoA
 
** 12:1(n-7)-CoA
 
** (5Z)-tetradec-5-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17796]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PROTON]][c] '''+''' 1.0 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1.0 [[CARBON-DIOXIDE]][c] '''+''' 1.0 [[S-ADENOSYLMETHIONINAMINE]][c]
* [[RXN-17795]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 H+[c] '''+''' 1.0 S-adenosyl-L-methionine[c] '''=>''' 1.0 CO2[c] '''+''' 1.0 S-adenosyl 3-(methylthio)propylamine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11030]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J}}
+
{{#set: common name=S-adenosyl-L-methionine carboxy-lyase}}
{{#set: common name=(5Z)-dodecenoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_11030}}
{{#set: molecular weight=943.792    }}
+
{{#set: in pathway=}}
{{#set: common name=12:1-Δ5-CoA|cis-5-tetradecenoyl-CoA|12:1(n-7)-CoA|(5Z)-tetradec-5-enoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: consumed by=RXN-17796}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: produced by=RXN-17795}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:21, 21 March 2018

Reaction AMCL

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • S-adenosyl-L-methionine carboxy-lyase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links