Difference between revisions of "CPD-9871"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tetradec-2-enoyl-ACPs Tetradec-2-enoyl-ACPs] == * common name: ** a trans tetradec-2-enoyl-[acp...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C | ||
* common name: | * common name: | ||
| − | ** | + | ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol |
| + | * inchi key: | ||
| + | ** InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N | ||
| + | * molecular weight: | ||
| + | ** 835.347 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol | ||
| + | ** 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9235]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986092 50986092] |
| − | {{#set: produced by=RXN- | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64181 64181] | ||
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C}} | ||
| + | {{#set: common name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}} | ||
| + | {{#set: inchi key=InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N}} | ||
| + | {{#set: molecular weight=835.347 }} | ||
| + | {{#set: common name=6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol|6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol}} | ||
| + | {{#set: produced by=RXN-9235}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-9871
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C
- common name:
- 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
- inchi key:
- InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N
- molecular weight:
- 835.347
- Synonym(s):
- 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol
- 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
