Difference between revisions of "Light"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-286 CPD-286] == * smiles: ** CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Light Light] == * common name: ** hν * Synonym(s): ** light ** a photon == Reaction(s) know...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-286 CPD-286] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Light Light] ==
−
* smiles:
+
−
** CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC(=O)CC4))
+
−
* inchi key:
+
−
** InChIKey=YCLWEYIBFOLMEM-FZPGBCFJSA-N
+
 
* common name:
 
* common name:
−
** 4,5α-dihydrocortisone
+
** hν
−
* molecular weight:
+
−
** 362.465   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** light
 +
** a photon
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15448]]
 +
* [[TransportSeed_Light]]
 +
* [[PSII-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TransportSeed_Light]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[CORTISONE-ALPHA-REDUCTASE-RXN]]
+
* [[ExchangeSeed_Light]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST02030096
+
{{#set: common name=hν}}
−
* PUBCHEM:
+
{{#set: common name=light|a photon}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440054 440054]
+
{{#set: consumed by=RXN-15448|TransportSeed_Light|PSII-RXN}}
−
* HMDB : HMDB02802
+
{{#set: produced by=TransportSeed_Light}}
−
* LIGAND-CPD:
+
{{#set: reversible reaction associated=ExchangeSeed_Light}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03588 C03588]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.389064.html 389064]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16372 16372]
+
−
{{#set: smiles=CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC(=O)CC4))}}
+
−
{{#set: inchi key=InChIKey=YCLWEYIBFOLMEM-FZPGBCFJSA-N}}
+
−
{{#set: common name=4,5α-dihydrocortisone}}
+
−
{{#set: molecular weight=362.465    }}
+
−
{{#set: consumed or produced by=CORTISONE-ALPHA-REDUCTASE-RXN}}
+

Latest revision as of 21:21, 21 March 2018

Metabolite Light

  • common name:
    • hν
  • Synonym(s):
    • light
    • a photon

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Light&oldid=48028"