Difference between revisions of "CPD-8985"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDTDm ATDTDm] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dTDP phosphotransferase, mito...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == * smiles: ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) * common name: ** (+)-(...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) |
* common name: | * common name: | ||
| − | ** | + | ** (+)-(1R,2R)-1,2-diphenylethane-1,2-diol |
| + | * inchi key: | ||
| + | ** InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N | ||
| + | * molecular weight: | ||
| + | ** 214.263 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[3.3.2.9-RXN]] | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=853019 853019] | |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.745456.html 745456] |
| − | {{#set: | + | * HMDB : HMDB12111 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50014 50014] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16015 C16015] | ||
| + | {{#set: smiles=C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)}} | ||
| + | {{#set: common name=(+)-(1R,2R)-1,2-diphenylethane-1,2-diol}} | ||
| + | {{#set: inchi key=InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N}} | ||
| + | {{#set: molecular weight=214.263 }} | ||
| + | {{#set: reversible reaction associated=3.3.2.9-RXN}} | ||
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite CPD-8985
- smiles:
- C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)
- common name:
- (+)-(1R,2R)-1,2-diphenylethane-1,2-diol
- inchi key:
- InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N
- molecular weight:
- 214.263
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
