Difference between revisions of "CPD-286"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8350 RXN-8350] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-286 CPD-286] == * smiles: ** CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-286 CPD-286] == |
− | * | + | * smiles: |
− | ** | + | ** CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC(=O)CC4)) |
− | * | + | * common name: |
− | ** | + | ** 4,5α-dihydrocortisone |
+ | * inchi key: | ||
+ | ** InChIKey=YCLWEYIBFOLMEM-FZPGBCFJSA-N | ||
+ | * molecular weight: | ||
+ | ** 362.465 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[CORTISONE-ALPHA-REDUCTASE-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIPID_MAPS : LMST02030096 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440054 440054] |
− | {{#set: | + | * HMDB : HMDB02802 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03588 C03588] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.389064.html 389064] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16372 16372] | ||
+ | {{#set: smiles=CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC(=O)CC4))}} | ||
+ | {{#set: common name=4,5α-dihydrocortisone}} | ||
+ | {{#set: inchi key=InChIKey=YCLWEYIBFOLMEM-FZPGBCFJSA-N}} | ||
+ | {{#set: molecular weight=362.465 }} | ||
+ | {{#set: reversible reaction associated=CORTISONE-ALPHA-REDUCTASE-RXN}} |
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite CPD-286
- smiles:
- CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC(=O)CC4))
- common name:
- 4,5α-dihydrocortisone
- inchi key:
- InChIKey=YCLWEYIBFOLMEM-FZPGBCFJSA-N
- molecular weight:
- 362.465
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMST02030096
- PUBCHEM:
- HMDB : HMDB02802
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CC34([CH]2([CH]([CH]1(C(C)(C(C(=O)CO)(O)CC1)CC(=O)2))CC[CH]3CC(=O)CC4))" cannot be used as a page name in this wiki.