Difference between revisions of "CYCLOARTENOL-SYNTHASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL-SYNTHASE-RXN CYCLOARTENOL-SYNTHASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number:...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL-SYNTHASE-RXN CYCLOARTENOL-SYNTHASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.4.99.8 EC-5.4.99.8] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[EPOXYSQUALENE]][c] '''=>''' 1 [[CYCLOARTENOL]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 (3S)-2,3-epoxy-2,3-dihydrosqualene[c] '''=>''' 1 cycloartenol[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Tiso_gene_14526]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7154]], ergosterol biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7154 PWY-7154] | ||
+ | ** '''1''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541] | ||
+ | ** '''10''' reactions found over '''36''' reactions in the full pathway | ||
+ | * [[PWY-6098]], diploterol and cycloartenol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6098 PWY-6098] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6109]], mangrove triterpenoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6109 PWY-6109] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-7155]], 7-dehydroporiferasterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7155 PWY-7155] | ||
+ | ** '''3''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-6115]], avenacin biosynthesis, initial reactions: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6115 PWY-6115] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21311 21311] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03200 R03200] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/O23909 O23909] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www. | + | {{#set: ec number=EC-5.4.99.8}} |
− | + | {{#set: gene associated=Tiso_gene_14526}} | |
− | + | {{#set: in pathway=PWY-7154|PWY-2541|PWY-6098|PWY-6109|PWY-7155|PWY-6115}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:21, 21 March 2018
Contents
Reaction CYCLOARTENOL-SYNTHASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 EPOXYSQUALENE[c] => 1 CYCLOARTENOL[c]
- With common name(s):
- 1 (3S)-2,3-epoxy-2,3-dihydrosqualene[c] => 1 cycloartenol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14526
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
Pathways
- PWY-7154, ergosterol biosynthesis II: PWY-7154
- 1 reactions found over 8 reactions in the full pathway
- PWY-2541, plant sterol biosynthesis: PWY-2541
- 10 reactions found over 36 reactions in the full pathway
- PWY-6098, diploterol and cycloartenol biosynthesis: PWY-6098
- 2 reactions found over 4 reactions in the full pathway
- PWY-6109, mangrove triterpenoid biosynthesis: PWY-6109
- 1 reactions found over 6 reactions in the full pathway
- PWY-7155, 7-dehydroporiferasterol biosynthesis: PWY-7155
- 3 reactions found over 10 reactions in the full pathway
- PWY-6115, avenacin biosynthesis, initial reactions: PWY-6115
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links