Difference between revisions of "CHORISMATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == * smiles: ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * common name:...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** chorismate |
| + | * inchi key: | ||
| + | ** InChIKey=WTFXTQVDAKGDEY-HTQZYQBOSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 224.17 |
* Synonym(s): | * Synonym(s): | ||
| + | ** chorismic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CHORISMATE-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[PABASYN-RXN]] | ||
| + | * [[CHORISMATEMUT-RXN]] | ||
| + | * [[ISOCHORSYN-RXN]] | ||
| + | * [[ANTHRANSYN-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 55508-12-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460312 5460312] |
| − | {{#set: smiles= | + | * HMDB : HMDB12199 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00251 C00251] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573889.html 4573889] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29748 29748] | ||
| + | * BIGG : chor | ||
| + | {{#set: smiles=C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1)}} | ||
| + | {{#set: common name=chorismate}} | ||
| + | {{#set: inchi key=InChIKey=WTFXTQVDAKGDEY-HTQZYQBOSA-L}} | ||
| + | {{#set: molecular weight=224.17 }} | ||
| + | {{#set: common name=chorismic acid}} | ||
| + | {{#set: produced by=CHORISMATE-SYNTHASE-RXN}} | ||
| + | {{#set: reversible reaction associated=PABASYN-RXN|CHORISMATEMUT-RXN|ISOCHORSYN-RXN|ANTHRANSYN-RXN}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CHORISMATE
- smiles:
- C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1)
- common name:
- chorismate
- inchi key:
- InChIKey=WTFXTQVDAKGDEY-HTQZYQBOSA-L
- molecular weight:
- 224.17
- Synonym(s):
- chorismic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 55508-12-8
- PUBCHEM:
- HMDB : HMDB12199
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : chor
"C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1)" cannot be used as a page name in this wiki.
