Difference between revisions of "RXN-12093"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12093 RXN-12093] == * direction: ** LEFT-TO-RIGHT * common name: ** 7-cyano-7-deazaguanine_synt...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12093 RXN-12093] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 7-cyano-7-deazaguanine_synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.3.4.20 EC-6.3.4.20] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[CPD-13043]][c] '''+''' 1 [[AMMONIUM]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[7-CYANO-7-DEAZAGUANINE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 7-carboxy-7-deazaguanine[c] '''+''' 1 ammonium[c] '''=>''' 1 phosphate[c] '''+''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 H2O[c] '''+''' 1 preQ0[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10965]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6703]], preQ0 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6703 PWY-6703] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27982 27982] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: common name=7-cyano-7-deazaguanine_synthase}} |
− | + | {{#set: ec number=EC-6.3.4.20}} | |
− | + | {{#set: gene associated=Tiso_gene_10965}} | |
− | + | {{#set: in pathway=PWY-6703}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:12, 21 March 2018
Contents
Reaction RXN-12093
- direction:
- LEFT-TO-RIGHT
- common name:
- 7-cyano-7-deazaguanine_synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 7-carboxy-7-deazaguanine[c] + 1 ammonium[c] => 1 phosphate[c] + 1 ADP[c] + 1 H+[c] + 1 H2O[c] + 1 preQ0[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10965
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA: