Difference between revisions of "ATPSYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPSYN-RXN ATPSYN-RXN] == * direction: ** REVERSIBLE * common name: ** v-type_proton_atpase ** ORF...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPSYN-RXN ATPSYN-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** v-type_proton_atpase |
− | * | + | ** ORF |
− | ** | + | ** vacuolar_h+-_sector_c |
+ | ** v-type_proton_atpase_catalytic_subunit_a | ||
+ | ** vacuolar_h+-atpase_v0_subunits_a | ||
+ | ** atp_synthase_gamma_chloroplastic | ||
+ | ** atp_synthase_gamma_subunit | ||
+ | ** atp_synthase_subunit_mitochondrial | ||
+ | ** ycf35 | ||
+ | ** atp_synthase_delta_mitochondrial | ||
+ | ** v-type_proton_atpase_subunit_h | ||
+ | ** v-type_protonatpasesubunitd1 | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.3.14 EC-3.6.3.14] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ADP]][c] '''+''' 4 [[PROTON]][e] '''+''' 1 [[Pi]][c] '''<=>''' 3 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[ATP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 ADP[c] '''+''' 4 H+[e] '''+''' 1 phosphate[c] '''<=>''' 3 H+[c] '''+''' 1 H2O[c] '''+''' 1 ATP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | + | * Gene: [[Tiso_gene_7213]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_2798]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_1366]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10981]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_15850]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_7215]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18105]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_6012]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_12618]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_11754]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9460]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_11192]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_11155]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5307]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6592]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17383]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_1365]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_11753]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7219]], adenosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7219 PWY-7219] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20852 20852] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | ** [http:// | + | {{#set: common name=v-type_proton_atpase}} |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: common name=vacuolar_h+-_sector_c}} | |
− | + | {{#set: common name=v-type_proton_atpase_catalytic_subunit_a}} | |
− | + | {{#set: common name=vacuolar_h+-atpase_v0_subunits_a}} | |
− | + | {{#set: common name=atp_synthase_gamma_chloroplastic}} | |
− | + | {{#set: common name=atp_synthase_gamma_subunit}} | |
− | + | {{#set: common name=atp_synthase_subunit_mitochondrial}} | |
− | + | {{#set: common name=ycf35}} | |
− | {{#set: | + | {{#set: common name=atp_synthase_delta_mitochondrial}} |
− | {{#set: | + | {{#set: common name=v-type_proton_atpase_subunit_h}} |
− | {{#set: common name= | + | {{#set: common name=v-type_protonatpasesubunitd1}} |
− | {{#set: | + | {{#set: ec number=EC-3.6.3.14}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_7213|Tiso_gene_2798|Tiso_gene_1366|Tiso_gene_10981|Tiso_gene_15850|Tiso_gene_7215|Tiso_gene_18105|Tiso_gene_6012|Tiso_gene_12618|Tiso_gene_11754|Tiso_gene_9460|Tiso_gene_11192|Tiso_gene_11155|Tiso_gene_5307|Tiso_gene_6592|Tiso_gene_17383|Tiso_gene_1365|Tiso_gene_11753}} |
− | {{#set: | + | {{#set: in pathway=PWY-7219}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|manual|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}} |
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:21, 21 March 2018
Contents
Reaction ATPSYN-RXN
- direction:
- REVERSIBLE
- common name:
- v-type_proton_atpase
- ORF
- vacuolar_h+-_sector_c
- v-type_proton_atpase_catalytic_subunit_a
- vacuolar_h+-atpase_v0_subunits_a
- atp_synthase_gamma_chloroplastic
- atp_synthase_gamma_subunit
- atp_synthase_subunit_mitochondrial
- ycf35
- atp_synthase_delta_mitochondrial
- v-type_proton_atpase_subunit_h
- v-type_protonatpasesubunitd1
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ADP[c] + 4 H+[e] + 1 phosphate[c] <=> 3 H+[c] + 1 H2O[c] + 1 ATP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7213
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2798
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_1366
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10981
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_15850
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_7215
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18105
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6012
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12618
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11754
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9460
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11192
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_11155
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5307
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6592
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17383
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1365
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11753
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7219, adenosine ribonucleotides de novo biosynthesis: PWY-7219
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA: