Difference between revisions of "Tiso gene 9421"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9421 == * Synonym(s): == Reactions associated == * Reaction: RXN-9537 ** Source: orthology-creinhardtii == Pathways associated ==...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] ==
+
== Gene Tiso_gene_9421 ==
* smiles:
+
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C
+
* inchi key:
+
** InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N
+
* common name:
+
** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
+
* molecular weight:
+
** 410.639   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-9537]]
* [[RXN-14917]]
+
** Source: [[orthology-creinhardtii]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5971]]
 +
* [[PWY-5994]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-9537}}
** [http://www.genome.jp/dbget-bin/www_bget?C20738 C20738]
+
{{#set: pathway associated=PWY-5971|PWY-5994}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75412 75412]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327035 5327035]
+
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C}}
+
{{#set: inchi key=InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N}}
+
{{#set: common name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: molecular weight=410.639    }}
+
{{#set: produced by=RXN-14917}}
+

Latest revision as of 20:21, 21 March 2018

Gene Tiso_gene_9421

  • Synonym(s):

Reactions associated

Pathways associated

External links