Difference between revisions of "Tiso gene 17637"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17637 == * right end position: ** 3472 * transcription direction: ** NEGATIVE * left end position: ** 2381 * centisome position: ** 66.8257...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
+
== Gene Tiso_gene_17637 ==
−
* smiles:
+
* right end position:
−
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
+
** 3472
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 5-hydroxyferulate
+
** 2381
−
* molecular weight:
+
* centisome position:
−
** 209.178    
+
** 66.82570    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxy ferulic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-3422]]
+
* Reaction: [[PHOSPHORIBULOKINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-1121]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[CALVIN-PWY]]
 +
* [[PWY-5723]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3472}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=2381}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
+
{{#set: centisome position=66.82570   }}
−
* HMDB : HMDB35484
+
{{#set: reaction associated=PHOSPHORIBULOKINASE-RXN}}
−
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
+
{{#set: pathway associated=CALVIN-PWY|PWY-5723}}
−
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
+
−
{{#set: common name=5-hydroxyferulate}}
+
−
{{#set: molecular weight=209.178   }}
+
−
{{#set: common name=5-hydroxy ferulic acid}}
+
−
{{#set: consumed by=RXN-3422}}
+
−
{{#set: produced by=RXN-1121}}
+

Latest revision as of 20:21, 21 March 2018

Gene Tiso_gene_17637

  • right end position:
    • 3472
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 2381
  • centisome position:
    • 66.82570
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17637&oldid=48089"