Difference between revisions of "CPD-17284"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17284 CPD-17284] == * common name: ** a [glycerolipid]-arachidonate * Synonym(s): ** a [gly...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17284 CPD-17284] ==
−
* smiles:
+
−
** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA
+
** a [glycerolipid]-arachidonate
−
* molecular weight:
+
−
** 1067.974   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate
 +
** a [glycerolipid]-arachidonic acid
 +
** a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate
 +
** a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16095]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16094]]
+
* [[RXN-8346]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a [glycerolipid]-arachidonate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581045 71581045]
+
{{#set: common name=a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate|a [glycerolipid]-arachidonic acid|a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate|a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate}}
−
* CHEBI:
+
{{#set: produced by=RXN-8346}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74012 74012]
+
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J}}
+
−
{{#set: common name=3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA}}
+
−
{{#set: molecular weight=1067.974    }}
+
−
{{#set: consumed by=RXN-16095}}
+
−
{{#set: produced by=RXN-16094}}
+

Latest revision as of 21:22, 21 March 2018

Metabolite CPD-17284

  • common name:
    • a [glycerolipid]-arachidonate
  • Synonym(s):
    • a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate
    • a [glycerolipid]-arachidonic acid
    • a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate
    • a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycerolipid]-arachidonate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-arachidonic acid" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-17284&oldid=48144"