Difference between revisions of "ACETYL-GLU"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] == * smiles: ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)[O-] * common name: ** N-acety...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=O)NC(C([O-])=O)CCC(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-L-glutamate |
+ | * inchi key: | ||
+ | ** InChIKey=RFMMMVDNIPUKGG-YFKPBYRVSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 187.152 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N-acetyl-L-glutamic acid |
+ | ** acetyl-L-glu | ||
+ | ** acetyl-L-glutamate | ||
+ | ** NAG | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[AGK]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[N-ACETYLTRANSFER-RXN]] | ||
+ | * [[ACETYLGLUTKIN-RXN]] | ||
== External links == | == External links == | ||
+ | * CAS : 1188-37-0 | ||
+ | * BIGG : acglu | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549099 1549099] |
− | {{#set: smiles= | + | * HMDB : HMDB01138 |
− | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00624 C00624] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.1266066.html 1266066] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=44337 44337] | ||
+ | * METABOLIGHTS : MTBLC44337 | ||
+ | {{#set: smiles=CC(=O)NC(C([O-])=O)CCC(=O)[O-]}} | ||
+ | {{#set: common name=N-acetyl-L-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=RFMMMVDNIPUKGG-YFKPBYRVSA-L}} | ||
+ | {{#set: molecular weight=187.152 }} | ||
+ | {{#set: common name=N-acetyl-L-glutamic acid|acetyl-L-glu|acetyl-L-glutamate|NAG}} | ||
+ | {{#set: consumed by=AGK}} | ||
+ | {{#set: produced by=GLUTAMATE-N-ACETYLTRANSFERASE-RXN}} | ||
+ | {{#set: reversible reaction associated=N-ACETYLTRANSFER-RXN|ACETYLGLUTKIN-RXN}} |
Latest revision as of 21:22, 21 March 2018
Contents
Metabolite ACETYL-GLU
- smiles:
- CC(=O)NC(C([O-])=O)CCC(=O)[O-]
- common name:
- N-acetyl-L-glutamate
- inchi key:
- InChIKey=RFMMMVDNIPUKGG-YFKPBYRVSA-L
- molecular weight:
- 187.152
- Synonym(s):
- N-acetyl-L-glutamic acid
- acetyl-L-glu
- acetyl-L-glutamate
- NAG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1188-37-0
- BIGG : acglu
- PUBCHEM:
- HMDB : HMDB01138
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC44337
"CC(=O)NC(C([O-])=O)CCC(=O)[O-" cannot be used as a page name in this wiki.