Difference between revisions of "RXN0-2921"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2921 RXN0-2921] == * direction: ** LEFT-TO-RIGHT * common name: ** folylpolyglutamate_synthase...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2921 RXN0-2921] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J
+
 
* common name:
 
* common name:
** OPC6-trans-2-enoyl-CoA
+
** folylpolyglutamate_synthase
* molecular weight:
+
** bifunctional_protein
** 1009.851   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.3.2.17 EC-6.3.2.17]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10704]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[GLT]][c] '''=>''' 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c]
* [[RXN-10706]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 ATP[c] '''+''' 1 a 5,10-methylene-tetrahydrofolate[c] '''+''' 1 L-glutamate[c] '''=>''' 1 a 5,10-methylene-tetrahydrofolate[c] '''+''' 1 phosphate[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_92]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15942]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237321 44237321]
+
{{#set: common name=folylpolyglutamate_synthase}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: common name=bifunctional_protein}}
{{#set: inchi key=InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J}}
+
{{#set: ec number=EC-6.3.2.17}}
{{#set: common name=OPC6-trans-2-enoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_92|Tiso_gene_15942}}
{{#set: molecular weight=1009.851    }}
+
{{#set: in pathway=PWY-2161}}
{{#set: consumed by=RXN-10704}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: produced by=RXN-10706}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:22, 21 March 2018

Reaction RXN0-2921

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • folylpolyglutamate_synthase
    • bifunctional_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 a 5,10-methylene-tetrahydrofolate[c] + 1 L-glutamate[c] => 1 a 5,10-methylene-tetrahydrofolate[c] + 1 phosphate[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2161, folate polyglutamylation: PWY-2161
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links