Difference between revisions of "CPD-7850"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16375 == * Synonym(s): == Reactions associated == * INORGPYROPHOSPHAT-RXN ** pantograph-esiliculosus == Pathways associated ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] == |
+ | * smiles: | ||
+ | ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C) | ||
+ | * common name: | ||
+ | ** echinenone | ||
+ | * inchi key: | ||
+ | ** InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N | ||
+ | * molecular weight: | ||
+ | ** 550.866 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[R07562]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPR01070060 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281236 5281236] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444648.html 4444648] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4746 4746] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08592 C08592] | ||
+ | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}} | ||
+ | {{#set: common name=echinenone}} | ||
+ | {{#set: inchi key=InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N}} | ||
+ | {{#set: molecular weight=550.866 }} | ||
+ | {{#set: consumed by=R07562}} |
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD-7850
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
- common name:
- echinenone
- inchi key:
- InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N
- molecular weight:
- 550.866
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links