Difference between revisions of "RXN0-722"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * smiles: ** C12(NC(=O)NC(C=1N=CN2)=O) * inchi key: ** InChIKey=LRFVTYWOQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate_re...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ribonucleoside-diphosphate_reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[UDP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[DUDP]][c] '''+''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 UDP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 dUDP[c] '''+''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 H2O[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | == | + | * Gene: [[Tiso_gene_10617]] |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10138]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9915]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9916]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166] | ||
+ | ** '''12''' reactions found over '''17''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ribonucleoside-diphosphate_reductase}} | |
− | + | {{#set: ec number=EC-1.17.4.1}} | |
− | + | {{#set: gene associated=Tiso_gene_10617|Tiso_gene_10138|Tiso_gene_9915|Tiso_gene_9916}} | |
− | + | {{#set: in pathway=PWY0-166}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:22, 21 March 2018
Contents
Reaction RXN0-722
- direction:
- LEFT-TO-RIGHT
- common name:
- ribonucleoside-diphosphate_reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 UDP[c] + 1 Reduced-NrdH-Proteins[c] => 1 DUDP[c] + 1 Oxidized-NrdH-Proteins[c] + 1 WATER[c]
- With common name(s):
- 1 UDP[c] + 1 a reduced NrdH glutaredoxin-like protein[c] => 1 dUDP[c] + 1 an oxidized NrdH glutaredoxin-like protein[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10617
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_10138
- Source: orthology-esiliculosus
- Gene: Tiso_gene_9915
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_9916
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY0-166, superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): PWY0-166
- 12 reactions found over 17 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation