Difference between revisions of "F-"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=F- F-] == * smiles: ** [F-] * common name: ** fluoride * inchi key: ** InChIKey=KRHYYFGTRYWZRS-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=F- F-] == |
* smiles: | * smiles: | ||
− | ** | + | ** [F-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** fluoride |
+ | * inchi key: | ||
+ | ** InChIKey=KRHYYFGTRYWZRS-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 18.998 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** fluoride ion |
− | ** | + | ** F- |
+ | ** F | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[TransportSeed_F-]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TransportSeed_F-]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ExchangeSeed_F-]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=28179 28179] |
− | * | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.26214.html 26214] | |
− | ** [http://www. | + | * HMDB : HMDB00662 |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17051 17051] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00742 C00742] |
− | + | {{#set: smiles=[F-]}} | |
− | {{#set: molecular weight= | + | {{#set: common name=fluoride}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=KRHYYFGTRYWZRS-UHFFFAOYSA-M}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=18.998 }} |
− | {{#set: produced by= | + | {{#set: common name=fluoride ion|F-|F}} |
+ | {{#set: consumed by=TransportSeed_F-}} | ||
+ | {{#set: produced by=TransportSeed_F-}} | ||
+ | {{#set: reversible reaction associated=ExchangeSeed_F-}} |
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite F-
- smiles:
- [F-]
- common name:
- fluoride
- inchi key:
- InChIKey=KRHYYFGTRYWZRS-UHFFFAOYSA-M
- molecular weight:
- 18.998
- Synonym(s):
- fluoride ion
- F-
- F
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links