Difference between revisions of "CPD-520"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13754 CPD-13754] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * co...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** quercetin |
+ | * inchi key: | ||
+ | ** InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 301.232 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,5,7,3',4'-pentahydroxyflavone |
+ | ** 3,5,7,3',4'-pentahydroflavone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-527]] | ||
+ | * [[RXN-12510]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906036 46906036] |
+ | * CAS : 117-39-5 | ||
+ | * Wikipedia : Quercetin | ||
+ | * NCI: | ||
+ | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9219 9219] | ||
+ | * HMDB : HMDB05794 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00389 C00389] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57694 57694] |
− | {{#set: smiles= | + | {{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))}} |
− | {{#set: | + | {{#set: common name=quercetin}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=301.232 }} |
− | {{#set: common name= | + | {{#set: common name=3,5,7,3',4'-pentahydroxyflavone|3,5,7,3',4'-pentahydroflavone}} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=QUERCETIN-3-O-METHYLTRANSFERASE-RXN}} |
+ | {{#set: produced by=RXN-527|RXN-12510}} |
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD-520
- smiles:
- C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))
- common name:
- quercetin
- inchi key:
- InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M
- molecular weight:
- 301.232
- Synonym(s):
- 3,5,7,3',4'-pentahydroxyflavone
- 3,5,7,3',4'-pentahydroflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- CAS : 117-39-5
- Wikipedia : Quercetin
- NCI:
- HMDB : HMDB05794
- LIGAND-CPD:
- CHEBI:
"C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))" cannot be used as a page name in this wiki.