Difference between revisions of "CPD-14596"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10406 == * left end position: ** 1164 * transcription direction: ** NEGATIVE * right end position: ** 2608 * centisome position: ** 13.5585...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * smiles: ** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_10406 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
* left end position:
+
* smiles:
** 1164
+
** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
* transcription direction:
+
* common name:
** NEGATIVE
+
** neolinustatin
* right end position:
+
* inchi key:
** 2608
+
** InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
* centisome position:
+
* molecular weight:
** 13.558533    
+
** 423.416    
 
* Synonym(s):
 
* Synonym(s):
 +
** butanenitrile
 +
** [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[1.3.1.20-RXN]]
+
* [[RXN-13603]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1164}}
+
* LIGAND-CPD:
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08336 C08336]
{{#set: right end position=2608}}
+
* HMDB : HMDB38482
{{#set: centisome position=13.558533   }}
+
* CHEBI:
{{#set: reaction associated=1.3.1.20-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7506 7506]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119533 119533]
 +
{{#set: smiles=CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
 +
{{#set: common name=neolinustatin}}
 +
{{#set: inchi key=InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N}}
 +
{{#set: molecular weight=423.416   }}
 +
{{#set: common name=butanenitrile|[(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]}}
 +
{{#set: consumed by=RXN-13603}}

Latest revision as of 21:22, 21 March 2018

Metabolite CPD-14596

  • smiles:
    • CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • common name:
    • neolinustatin
  • inchi key:
    • InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
  • molecular weight:
    • 423.416
  • Synonym(s):
    • butanenitrile
    • [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links