Difference between revisions of "RXN-14024"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] == * smiles: ** [CH](=O)C(O)C(=O)[O-] * inchi key: ** InChIK...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14024 RXN-14024] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14024 RXN-14024] ==
* smiles:
+
* direction:
** [CH](=O)C(O)C(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** tartronate semialdehyde
+
** ORF
* molecular weight:
+
* ec number:
** 103.054   
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
 
* Synonym(s):
 
* Synonym(s):
** 2-hydroxy-3-oxopropanoate
 
** tartronic semialdehyde
 
** hydroxymalonaldehydic acid
 
** tartronate-S-ald
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R01747]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2 [[WATER]][c] '''+''' 1 [[Nucleoside-Triphosphates]][c] '''=>''' 1 [[Nucleoside-Monophosphates]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Pi]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[RXN0-5289]]
+
** 2 H2O[c] '''+''' 1 a nucleoside triphosphate[c] '''=>''' 1 a nucleoside 5'-monophosphate[c] '''+''' 2 H+[c] '''+''' 2 phosphate[c]
* [[RXN0-305]]
+
 
* [[4.1.2.20-RXN]]
+
== Genes associated with this reaction  ==
* [[KDGALDOL-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13653]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 2480-77-5
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=ORF}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22134427 22134427]
+
{{#set: ec number=EC-3.6.1.5}}
* HMDB : HMDB06938
+
{{#set: gene associated=Tiso_gene_13653|Tiso_gene_12899|Tiso_gene_20236}}
* LIGAND-CPD:
+
{{#set: in pathway=}}
** [http://www.genome.jp/dbget-bin/www_bget?C01146 C01146]
+
{{#set: reconstruction category=orthology|annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57978 57978]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
* BIGG : 2h3oppan
+
{{#set: smiles=[CH](=O)C(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M}}
+
{{#set: common name=tartronate semialdehyde}}
+
{{#set: molecular weight=103.054    }}
+
{{#set: common name=2-hydroxy-3-oxopropanoate|tartronic semialdehyde|hydroxymalonaldehydic acid|tartronate-S-ald}}
+
{{#set: consumed by=R01747}}
+
{{#set: consumed or produced by=RXN0-5289|RXN0-305|4.1.2.20-RXN|KDGALDOL-RXN}}
+

Latest revision as of 20:22, 21 March 2018

Reaction RXN-14024

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links