Difference between revisions of "L-RIBULOSE-5-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11148 == * left end position: ** 2885 * transcription direction: ** NEGATIVE * right end position: ** 4599 * centisome position: ** 36.0986...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * common name...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_11148 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] ==
−
* left end position:
+
* smiles:
−
** 2885
+
** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** L-ribulose 5-phosphate
−
* right end position:
+
* inchi key:
−
** 4599
+
** InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
−
* centisome position:
+
* molecular weight:
−
** 36.0986    
+
** 228.095    
 
* Synonym(s):
 
* Synonym(s):
 +
** L-ribulose-5-P
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15556]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN0-5116]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2885}}
+
* CAS : 2922-69-2
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=4599}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145006 21145006]
−
{{#set: centisome position=36.0986   }}
+
* LIGAND-CPD:
−
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01101 C01101]
−
{{#set: pathway associated=PWY-7511}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.20015750.html 20015750]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58226 58226]
 +
* BIGG : ru5p__L
 +
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO}}
 +
{{#set: common name=L-ribulose 5-phosphate}}
 +
{{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L}}
 +
{{#set: molecular weight=228.095   }}
 +
{{#set: common name=L-ribulose-5-P}}
 +
{{#set: produced by=RXN0-5116}}

Latest revision as of 20:22, 21 March 2018

Metabolite L-RIBULOSE-5-P

  • smiles:
    • C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
  • common name:
    • L-ribulose 5-phosphate
  • inchi key:
    • InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • L-ribulose-5-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-RIBULOSE-5-P&oldid=48273"