Difference between revisions of "Tiso gene 16604"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_16604 == * right end position: ** 3796 * transcription direction: ** POSITIVE * left end position: ** 61 * centisome position: ** 1.4315889...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_16604 == |
| − | * | + | * right end position: |
| − | ** | + | ** 3796 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 61 |
| − | * | + | * centisome position: |
| − | ** | + | ** 1.4315889 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[DISULFOXRED-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | + | *** Assignment: automated-name-match | |
| − | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: right end position=3796}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=61}} |
| − | {{#set: | + | {{#set: centisome position=1.4315889 }} |
| − | {{#set: | + | {{#set: reaction associated=DISULFOXRED-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 20:23, 21 March 2018
Gene Tiso_gene_16604
- right end position:
- 3796
- transcription direction:
- POSITIVE
- left end position:
- 61
- centisome position:
- 1.4315889
- Synonym(s):
Reactions associated
- Reaction: DISULFOXRED-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
