Difference between revisions of "NADHor 2m"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == * smiles: ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADHor_2m NADHor_2m] == * direction: ** LEFT-TO-RIGHT * common name: ** NADH oxidoreductase, mitoch...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADHor_2m NADHor_2m] ==
* smiles:
+
* direction:
** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
+
 
* common name:
 
* common name:
** dihydrodemethylsterigmatocystin
+
** NADH oxidoreductase, mitochondria
* molecular weight:
+
** 312.278   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9500]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PROTON]][m] '''+''' 1.0 [[NADH]][m] '''+''' 1.0 [[UBIQUINONE-8]][m] '''=>''' 1.0 [[NAD]][m] '''+''' 1.0 [[CPD-9956]][m]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H+[m] '''+''' 1.0 NADH[m] '''+''' 1.0 ubiquinone-8[m] '''=>''' 1.0 NAD+[m] '''+''' 1.0 ubiquinol-8[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3113]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C20444 C20444]
+
{{#set: common name=NADH oxidoreductase, mitochondria}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_3113}}
** [http://www.chemspider.com/Chemical-Structure.4588953.html 4588953]
+
{{#set: in pathway=}}
* HMDB : HMDB33658
+
{{#set: reconstruction category=orthology}}
* PUBCHEM:
+
{{#set: reconstruction source=orthology-creinhardtii}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20832874 20832874]
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))}}
+
{{#set: inchi key=InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N}}
+
{{#set: common name=dihydrodemethylsterigmatocystin}}
+
{{#set: molecular weight=312.278    }}
+
{{#set: consumed by=RXN-9500}}
+

Latest revision as of 20:23, 21 March 2018

Reaction NADHor_2m

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • NADH oxidoreductase, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[m] + 1.0 NADH[m] + 1.0 ubiquinone-8[m] => 1.0 NAD+[m] + 1.0 ubiquinol-8[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links