Difference between revisions of "23-DIPHOSPHOGLYCERATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurases L-Cysteine-Desulfurases] == * common name: ** an [L-cysteine desulfuras...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * smiles: ** C(OP(=O)([O-])[O-])C(OP(=O)([O-])[...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** 2,3-diphospho-D-glycerate |
| + | * inchi key: | ||
| + | ** InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I | ||
| + | * molecular weight: | ||
| + | ** 260.998 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2,3-bisphosphoglycerate | ||
| + | ** D-Greenwald ester | ||
| + | ** 2,3-P2-D-glycerate | ||
| + | ** 2,3-bisphospho-D-glycerate | ||
| + | ** 2,3-diphosphoglycerate | ||
| + | ** DPG | ||
| + | ** 2,3-bisPGA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15512]] | ||
| + | * [[RXN-15509]] | ||
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15511]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01159 C01159] |
| − | {{#set: | + | * HMDB : HMDB01294 |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58248 58248] | ||
| + | * METABOLIGHTS : MTBLC58248 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200383 25200383] | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]}} | ||
| + | {{#set: common name=2,3-diphospho-D-glycerate}} | ||
| + | {{#set: inchi key=InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I}} | ||
| + | {{#set: molecular weight=260.998 }} | ||
| + | {{#set: common name=2,3-bisphosphoglycerate|D-Greenwald ester|2,3-P2-D-glycerate|2,3-bisphospho-D-glycerate|2,3-diphosphoglycerate|DPG|2,3-bisPGA}} | ||
| + | {{#set: reversible reaction associated=RXN-15512|RXN-15509|RXN-15510|RXN-15511}} | ||
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- smiles:
- C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]
- common name:
- 2,3-diphospho-D-glycerate
- inchi key:
- InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I
- molecular weight:
- 260.998
- Synonym(s):
- 2,3-bisphosphoglycerate
- D-Greenwald ester
- 2,3-P2-D-glycerate
- 2,3-bisphospho-D-glycerate
- 2,3-diphosphoglycerate
- DPG
- 2,3-bisPGA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-" cannot be used as a page name in this wiki.
