Difference between revisions of "2-METHYL-BUTYRYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-2-thiouridine34 tRNA-2-thiouridine34] == * common name: ** a 2-thiouridine34 in tRNA * Syn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == * smiles: ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == |
| + | * smiles: | ||
| + | ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-methylbutanoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J | ||
| + | * molecular weight: | ||
| + | ** 847.62 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** S-2-methyl-butyryl-CoA |
| + | ** 2-methylbutyryl-CoA | ||
| + | ** α-methylbutyryl-CoA | ||
| + | ** α-methylbutanoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[MCDH_2mb2coa]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DHRT_2mbcoa]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2KETO-3METHYLVALERATE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266569 45266569] |
| − | {{#set: produced by= | + | * HMDB : HMDB01041 |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57336 57336] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01033 C01033] | ||
| + | {{#set: smiles=CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: common name=2-methylbutanoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J}} | ||
| + | {{#set: molecular weight=847.62 }} | ||
| + | {{#set: common name=S-2-methyl-butyryl-CoA|2-methylbutyryl-CoA|α-methylbutyryl-CoA|α-methylbutanoyl-CoA}} | ||
| + | {{#set: consumed by=MCDH_2mb2coa}} | ||
| + | {{#set: produced by=DHRT_2mbcoa}} | ||
| + | {{#set: reversible reaction associated=2KETO-3METHYLVALERATE-RXN}} | ||
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite 2-METHYL-BUTYRYL-COA
- smiles:
- CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 2-methylbutanoyl-CoA
- inchi key:
- InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J
- molecular weight:
- 847.62
- Synonym(s):
- S-2-methyl-butyryl-CoA
- 2-methylbutyryl-CoA
- α-methylbutyryl-CoA
- α-methylbutanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
