Difference between revisions of "S-LACTOYL-GLUTATHIONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-MET-tRNAs Charged-MET-tRNAs] == * common name: ** an L-methionyl-[elongator tRNAmet] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == |
| + | * smiles: | ||
| + | ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-S-lactoylglutathione |
| + | * inchi key: | ||
| + | ** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M | ||
| + | * molecular weight: | ||
| + | ** 378.376 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** S-D-lactoylglutathione |
| − | ** | + | ** D-lactoylglutathione |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLYOXII-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GLYOXI-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 25138-66-3 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377] |
| + | * HMDB : HMDB01066 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474] | ||
| + | * BIGG : lgt__S | ||
| + | {{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | ||
| + | {{#set: common name=(R)-S-lactoylglutathione}} | ||
| + | {{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}} | ||
| + | {{#set: molecular weight=378.376 }} | ||
| + | {{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}} | ||
| + | {{#set: consumed by=GLYOXII-RXN}} | ||
| + | {{#set: reversible reaction associated=GLYOXI-RXN}} | ||
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite S-LACTOYL-GLUTATHIONE
- smiles:
- CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- common name:
- (R)-S-lactoylglutathione
- inchi key:
- InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
- molecular weight:
- 378.376
- Synonym(s):
- S-D-lactoylglutathione
- D-lactoylglutathione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
