Difference between revisions of "GLYCOLALD-DEHYDROG-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLALD-DEHYDROG-RXN GLYCOLALD-DEHYDROG-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [ht...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLALD-DEHYDROG-RXN GLYCOLALD-DEHYDROG-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.2.1.21 EC-1.2.1.21] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NAD]][c] '''+''' 1 [[GLYCOLALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[GLYCOLLATE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 NAD+[c] '''+''' 1 glycolaldehyde[c] '''+''' 1 H2O[c] '''=>''' 2 H+[c] '''+''' 1 NADH[c] '''+''' 1 glycolate[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_7322]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY0-1280]], ethylene glycol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1280 PWY0-1280] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[DARABCATK12-PWY]], D-arabinose degradation I: [http://metacyc.org/META/NEW-IMAGE?object=DARABCATK12-PWY DARABCATK12-PWY] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20001 20001] |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01333 R01333] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.2.1.21}} |
− | + | {{#set: gene associated=Tiso_gene_7322}} | |
− | + | {{#set: in pathway=PWY0-1280|DARABCATK12-PWY}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-synechocystis}} |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:23, 21 March 2018
Contents
Reaction GLYCOLALD-DEHYDROG-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 GLYCOLALDEHYDE[c] + 1 WATER[c] => 2 PROTON[c] + 1 NADH[c] + 1 GLYCOLLATE[c]
- With common name(s):
- 1 NAD+[c] + 1 glycolaldehyde[c] + 1 H2O[c] => 2 H+[c] + 1 NADH[c] + 1 glycolate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7322
- Source: orthology-synechocystis
Pathways
- PWY0-1280, ethylene glycol degradation: PWY0-1280
- 1 reactions found over 2 reactions in the full pathway
- DARABCATK12-PWY, D-arabinose degradation I: DARABCATK12-PWY
- 1 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
External links