Difference between revisions of "CPD-2750"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16674 == * Synonym(s): == Reactions associated == * ACOA120or ** pantograph-creinhardtii * ACOA140or ** pantograph-c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * common name: ** tran...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == |
+ | * smiles: | ||
+ | ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) | ||
+ | * common name: | ||
+ | ** trans-3'-hydroxycotinine | ||
+ | * inchi key: | ||
+ | ** InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N | ||
+ | * molecular weight: | ||
+ | ** 192.217 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN66-162]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-161]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107963 107963] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.97080.html 97080] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71182 71182] | ||
+ | * METABOLIGHTS : MTBLC71182 | ||
+ | * HMDB : HMDB01390 | ||
+ | {{#set: smiles=C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))}} | ||
+ | {{#set: common name=trans-3'-hydroxycotinine}} | ||
+ | {{#set: inchi key=InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N}} | ||
+ | {{#set: molecular weight=192.217 }} | ||
+ | {{#set: consumed by=RXN66-162}} | ||
+ | {{#set: produced by=RXN66-161}} |
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite CPD-2750
- smiles:
- C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))
- common name:
- trans-3'-hydroxycotinine
- inchi key:
- InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N
- molecular weight:
- 192.217
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.