Difference between revisions of "Tiso gene 1462"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...")
 
(Created page with "Category:Gene == Gene Tiso_gene_1462 == * right end position: ** 10587 * transcription direction: ** POSITIVE * left end position: ** 8805 * centisome position: ** 37.1331...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
+
== Gene Tiso_gene_1462 ==
* smiles:
+
* right end position:
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 10587
* inchi key:
+
* transcription direction:
** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
+
** POSITIVE
* common name:
+
* left end position:
** 3-oxo-24-ethyl-cholest-5-ene
+
** 8805
* molecular weight:
+
* centisome position:
** 412.698    
+
** 37.1331    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ASNSYNA-RXN]]
* [[RXN-12789]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[ASPARAGINESYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=10587}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: left end position=8805}}
{{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}}
+
{{#set: centisome position=37.1331    }}
{{#set: common name=3-oxo-24-ethyl-cholest-5-ene}}
+
{{#set: reaction associated=ASNSYNA-RXN}}
{{#set: molecular weight=412.698    }}
+
{{#set: pathway associated=ASPARAGINESYN-PWY}}
{{#set: produced by=RXN-12789}}
+

Latest revision as of 20:24, 21 March 2018

Gene Tiso_gene_1462

  • right end position:
    • 10587
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8805
  • centisome position:
    • 37.1331
  • Synonym(s):

Reactions associated

Pathways associated

External links