Difference between revisions of "Mitochondrial-Preproteins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * inchi key: ** InChIKe...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitochondrial-Preproteins Mitochondrial-Preproteins] == * common name: ** a mitochondrial prepr...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitochondrial-Preproteins Mitochondrial-Preproteins] ==
* smiles:
+
** CC(=O)C(C)(O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
** (S)-2-acetolactate
+
** a mitochondrial preprotein including a mitochondrial targeting sequence
* molecular weight:
+
** 131.108   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-2-hydroxy-2-methyl-3-oxobutanoate
 
** α-acetolactate
 
** (2S)-2-hydroxy-2-methyl-3-oxobutanoate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6081]]
+
* [[3.4.24.64-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETOLACTSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ACETOLACTREDUCTOISOM-RXN]]
 
* [[RXN-14037]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a mitochondrial preprotein including a mitochondrial targeting sequence}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770]
+
{{#set: consumed by=3.4.24.64-RXN}}
* HMDB : HMDB06855
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476]
+
* BIGG : alac__S
+
{{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}}
+
{{#set: common name=(S)-2-acetolactate}}
+
{{#set: molecular weight=131.108    }}
+
{{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}}
+
{{#set: consumed by=RXN-6081}}
+
{{#set: produced by=ACETOLACTSYN-RXN}}
+
{{#set: consumed or produced by=ACETOLACTREDUCTOISOM-RXN|RXN-14037}}
+

Latest revision as of 20:24, 21 March 2018

Metabolite Mitochondrial-Preproteins

  • common name:
    • a mitochondrial preprotein including a mitochondrial targeting sequence
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links