Difference between revisions of "RXN-7674"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * inchi...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7674 RXN-7674] == * direction: ** LEFT-TO-RIGHT * common name: ** chlorophyll_chloroplastic * e...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7674 RXN-7674] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L
+
 
* common name:
 
* common name:
−
** 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide
+
** chlorophyll_chloroplastic
−
* molecular weight:
+
* ec number:
−
** 336.197   
+
** [http://enzyme.expasy.org/EC/2.5.1.62 EC-2.5.1.62]
 
* Synonym(s):
 
* Synonym(s):
−
** Z-nucleotide
 
−
** AICAR
 
−
** AICA ribonucleotide
 
−
** 5'-phosphoribosyl-5-amino-4-imidazole carboxamide
 
−
** 5-amino-4-imidazolecarboxamide ribotide
 
−
** 5'-P-ribosyl-5-amino-4-imidazole carboxamide
 
−
** aminoimidazole carboxamide ribonucleotide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[R04560]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-7014]][c] '''+''' 1 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CHLOROPHYLL-B]][c]
−
* [[GLUTAMIDOTRANS-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 chlorophyllide b[c] '''+''' 1 phytyl diphosphate[c] '''+''' 2 H+[c] '''=>''' 1 diphosphate[c] '''+''' 1 chlorophyll b[c]
−
* [[FPAIF]]
+
 
−
* [[AICARTRANSFORM-RXN]]
+
== Genes associated with this reaction  ==
−
* [[AIAL]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[AICARSYN-RXN]]
+
* Gene: [[Tiso_gene_19542]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[PWY-5068]], chlorophyll cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 3031-94-5
+
* LIGAND-RXN:
−
* METABOLIGHTS : MTBLC58475
+
** [http://www.genome.jp/dbget-bin/www_bget?R09067 R09067]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266657 45266657]
+
{{#set: common name=chlorophyll_chloroplastic}}
−
* HMDB : HMDB01517
+
{{#set: ec number=EC-2.5.1.62}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_19542}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04677 C04677]
+
{{#set: in pathway=PWY-5068}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58475 58475]
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-creinhardtii}}
−
* BIGG : aicar
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))}}
+
−
{{#set: inchi key=InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L}}
+
−
{{#set: common name=5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide}}
+
−
{{#set: molecular weight=336.197    }}
+
−
{{#set: common name=Z-nucleotide|AICAR|AICA ribonucleotide|5'-phosphoribosyl-5-amino-4-imidazole carboxamide|5-amino-4-imidazolecarboxamide ribotide|5'-P-ribosyl-5-amino-4-imidazole carboxamide|aminoimidazole carboxamide ribonucleotide}}
+
−
{{#set: consumed by=R04560}}
+
−
{{#set: produced by=GLUTAMIDOTRANS-RXN}}
+
−
{{#set: consumed or produced by=FPAIF|AICARTRANSFORM-RXN|AIAL|AICARSYN-RXN}}
+

Latest revision as of 20:24, 21 March 2018

Reaction RXN-7674

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chlorophyll_chloroplastic
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5068, chlorophyll cycle: PWY-5068
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7674&oldid=48514"