Difference between revisions of "AICAR"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17428 RXN-17428] == * direction: ** LEFT-TO-RIGHT * common name: ** geranylgeranyl_diphosphate_...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * commo...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) |
* common name: | * common name: | ||
− | ** | + | ** 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L |
+ | * molecular weight: | ||
+ | ** 336.197 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Z-nucleotide | ||
+ | ** AICAR | ||
+ | ** AICA ribonucleotide | ||
+ | ** 5'-phosphoribosyl-5-amino-4-imidazole carboxamide | ||
+ | ** 5-amino-4-imidazolecarboxamide ribotide | ||
+ | ** 5'-P-ribosyl-5-amino-4-imidazole carboxamide | ||
+ | ** aminoimidazole carboxamide ribonucleotide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[R04560]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GLUTAMIDOTRANS-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[FPAIF]] | |
− | = | + | * [[AICARTRANSFORM-RXN]] |
− | + | * [[AIAL]] | |
− | * [[ | + | * [[AICARSYN-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 3031-94-5 | |
− | + | * BIGG : aicar | |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266657 45266657] |
− | {{#set: | + | * HMDB : HMDB01517 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04677 C04677] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58475 58475] |
− | {{#set: | + | * METABOLIGHTS : MTBLC58475 |
− | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))}} |
+ | {{#set: common name=5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide}} | ||
+ | {{#set: inchi key=InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L}} | ||
+ | {{#set: molecular weight=336.197 }} | ||
+ | {{#set: common name=Z-nucleotide|AICAR|AICA ribonucleotide|5'-phosphoribosyl-5-amino-4-imidazole carboxamide|5-amino-4-imidazolecarboxamide ribotide|5'-P-ribosyl-5-amino-4-imidazole carboxamide|aminoimidazole carboxamide ribonucleotide}} | ||
+ | {{#set: consumed by=R04560}} | ||
+ | {{#set: produced by=GLUTAMIDOTRANS-RXN}} | ||
+ | {{#set: reversible reaction associated=FPAIF|AICARTRANSFORM-RXN|AIAL|AICARSYN-RXN}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite AICAR
- smiles:
- C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))
- common name:
- 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide
- inchi key:
- InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L
- molecular weight:
- 336.197
- Synonym(s):
- Z-nucleotide
- AICAR
- AICA ribonucleotide
- 5'-phosphoribosyl-5-amino-4-imidazole carboxamide
- 5-amino-4-imidazolecarboxamide ribotide
- 5'-P-ribosyl-5-amino-4-imidazole carboxamide
- aminoimidazole carboxamide ribonucleotide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 3031-94-5
- BIGG : aicar
- PUBCHEM:
- HMDB : HMDB01517
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58475
"C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))" cannot be used as a page name in this wiki.