Difference between revisions of "HYPOXANPRIBOSYLTRAN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=JKTYG...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANPRIBOSYLTRAN-RXN HYPOXANPRIBOSYLTRAN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: **...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANPRIBOSYLTRAN-RXN HYPOXANPRIBOSYLTRAN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** xanthine_phosphoribosyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.2.8 EC-2.4.2.8] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[PRPP]][c] '''+''' 1 [[HYPOXANTHINE]][c] '''=>''' 1 [[IMP]][c] '''+''' 1 [[PPI]][c] |
− | == | + | * With common name(s): |
+ | ** 1 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1 hypoxanthine[c] '''=>''' 1 IMP[c] '''+''' 1 diphosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_13506]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6609]], adenine and adenosine salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6609 PWY-6609] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6610]], adenine salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6610 PWY-6610] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17973 17973] |
− | ** [http:// | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01132 R01132] |
− | ** [http://www. | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JWG0 Q9JWG0] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P45078 P45078] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q59049 Q59049] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/O27375 O27375] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q64531 Q64531] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q8IJS1 Q8IJS1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00492 P00492] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00494 P00494] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00493 P00493] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P09383 P09383] |
+ | ** [http://www.uniprot.org/uniprot/P07833 P07833] | ||
+ | ** [http://www.uniprot.org/uniprot/P20035 P20035] | ||
+ | ** [http://www.uniprot.org/uniprot/P18134 P18134] | ||
+ | ** [http://www.uniprot.org/uniprot/P27605 P27605] | ||
+ | ** [http://www.uniprot.org/uniprot/P37171 P37171] | ||
+ | ** [http://www.uniprot.org/uniprot/Q64401 Q64401] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02522 Q02522] | ||
+ | ** [http://www.uniprot.org/uniprot/Q07010 Q07010] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8X945 Q8X945] | ||
+ | ** [http://www.uniprot.org/uniprot/P42085 P42085] | ||
+ | ** [http://www.uniprot.org/uniprot/P37472 P37472] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZNK6 Q9ZNK6] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=xanthine_phosphoribosyltransferase}} | ||
+ | {{#set: ec number=EC-2.4.2.8}} | ||
+ | {{#set: gene associated=Tiso_gene_13506}} | ||
+ | {{#set: in pathway=PWY-6609|PWY-6610}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:24, 21 March 2018
Contents
Reaction HYPOXANPRIBOSYLTRAN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- xanthine_phosphoribosyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PRPP[c] + 1 HYPOXANTHINE[c] => 1 IMP[c] + 1 PPI[c]
- With common name(s):
- 1 5-phospho-α-D-ribose 1-diphosphate[c] + 1 hypoxanthine[c] => 1 IMP[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13506
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-6609, adenine and adenosine salvage III: PWY-6609
- 3 reactions found over 4 reactions in the full pathway
- PWY-6610, adenine salvage: PWY-6610
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: