Difference between revisions of "RXN-17857"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * smiles: ** C1(NC2(=C(N=1)N=CNC(=O)2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17857 RXN-17857] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17857 RXN-17857] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.3.1.bv EC-2.3.1.bv] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ACETYL-COA]][c] '''+''' 1 [[L-methionyl-L-tryptophanyl-Protein]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[N-Ac-L-methionyl-L-tryptophanyl-Protein]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 acetyl-CoA[c] '''+''' 1 an N-terminal-L-methionyl-L-tryptophanyl-[protein][c] '''=>''' 1 H+[c] '''+''' 1 coenzyme A[c] '''+''' 1 an N-terminal Nα-acetyl-L-methionyl-L-tryptophanyl-[protein][c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | == Pathways == | ||
+ | * [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800] | ||
+ | ** '''21''' reactions found over '''21''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.3.1.bv}} | |
− | + | {{#set: in pathway=PWY-7800}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:24, 21 March 2018
Contents
Reaction RXN-17857
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACETYL-COA[c] + 1 L-methionyl-L-tryptophanyl-Protein[c] => 1 PROTON[c] + 1 CO-A[c] + 1 N-Ac-L-methionyl-L-tryptophanyl-Protein[c]
- With common name(s):
- 1 acetyl-CoA[c] + 1 an N-terminal-L-methionyl-L-tryptophanyl-[protein][c] => 1 H+[c] + 1 coenzyme A[c] + 1 an N-terminal Nα-acetyl-L-methionyl-L-tryptophanyl-[protein][c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation