Difference between revisions of "R00476"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * smiles: ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00476 R00476] == * direction: ** LEFT-TO-RIGHT * common name: ** R532 * Synonym(s): == Reaction F...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00476 R00476] ==
* smiles:
+
* direction:
** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D
+
 
* common name:
 
* common name:
** D-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** R532
* molecular weight:
+
** 569.977   
+
 
* Synonym(s):
 
* Synonym(s):
** Ins(1,3,4,5,6)P5
 
** 1D-myo-inositol 1,3,4,5,6-pentakisphosphate
 
** inositol 1,3,4,5,6-pentakisphosphate
 
** I(1,3,4,5,6)P5
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10955]]
+
* With identifiers:
* [[RXN-7163]]
+
** 1.0 [[GLYCOLLATE]][c] '''+''' 1.0 [[NAD]][c] '''=>''' 1.0 [[GLYOX]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[2.7.1.134-RXN]]
+
** 1.0 glycolate[c] '''+''' 1.0 NAD+[c] '''=>''' 1.0 glyoxylate[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADH[c]
* [[2.7.1.140-RXN]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18014]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C01284 C01284]
+
{{#set: common name=R532}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_18014}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27570 27570]
+
{{#set: in pathway=}}
* METABOLIGHTS : MTBLC57733
+
{{#set: reconstruction category=orthology}}
* HMDB : HMDB03529
+
{{#set: reconstruction source=orthology-synechocystis}}
{{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D}}
+
{{#set: common name=D-myo-inositol 1,3,4,5,6-pentakisphosphate}}
+
{{#set: molecular weight=569.977    }}
+
{{#set: common name=Ins(1,3,4,5,6)P5|1D-myo-inositol 1,3,4,5,6-pentakisphosphate|inositol 1,3,4,5,6-pentakisphosphate|I(1,3,4,5,6)P5}}
+
{{#set: consumed by=RXN-10955|RXN-7163}}
+
{{#set: produced by=2.7.1.134-RXN|2.7.1.140-RXN}}
+

Latest revision as of 20:25, 21 March 2018

Reaction R00476

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R532
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 glycolate[c] + 1.0 NAD+[c] => 1.0 glyoxylate[c] + 1.0 H+[c] + 1.0 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links