Difference between revisions of "Tiso gene 12450"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_12450 == * Synonym(s): == Reactions associated == * Reaction: 3.4.23.1-RXN ** Source: orthology-esiliculosus * Reaction: RXN-844...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12450 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.23.1-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | * Reaction: [[RXN-8443]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.4.23.1-RXN|RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:25, 21 March 2018
Gene Tiso_gene_12450
- Synonym(s):
Reactions associated
- Reaction: 3.4.23.1-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-8443
- Source: orthology-athaliana
- Source: orthology-esiliculosus