Difference between revisions of "CPD0-2244"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P345-PWY P345-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P345-PWY P345-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** aldoxime degradation
+
** (S)-3-hydroxydecanoyl-CoA
 +
* inchi key:
 +
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
 +
* molecular weight:
 +
** 933.753   
 
* Synonym(s):
 
* Synonym(s):
** aldoxime metabolism
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
* [[RXN-12490]]
** [[R313-RXN]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
* [[RXN-13616]]
* '''2''' reaction(s) not found
+
== Reaction(s) of unknown directionality ==
** [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMID-RXN NICOTINAMID-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=R312-RXN R312-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* LIGAND-CPD:
{{#set: taxonomic range=TAX-2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
{{#set: common name=aldoxime degradation}}
+
* HMDB : HMDB03938
{{#set: common name=aldoxime metabolism}}
+
* CHEBI:
{{#set: reaction found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
{{#set: reaction not found=2}}
+
* BIGG : 3hdcoa
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
 +
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
 +
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
 +
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
 +
{{#set: molecular weight=933.753    }}
 +
{{#set: consumed by=RXN-12490}}
 +
{{#set: produced by=RXN-13616}}

Latest revision as of 19:05, 21 March 2018

Metabolite CPD0-2244

  • smiles:
    • CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
  • common name:
    • (S)-3-hydroxydecanoyl-CoA
  • inchi key:
    • InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
  • molecular weight:
    • 933.753
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.