Difference between revisions of "CPD-10330"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydro-suc-DH-lipoyl Oxo-glutarate-dehydro-suc-DH-lipoyl] == * common name: ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * common name: ** α-D-ribofur...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == |
| + | * smiles: | ||
| + | ** C(C1(C(C(C(O1)O)O)O))O | ||
* common name: | * common name: | ||
| − | ** | + | ** α-D-ribofuranose |
| + | * inchi key: | ||
| + | ** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N | ||
| + | * molecular weight: | ||
| + | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** α D-ribose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RIBOKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-14904]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.5575.html 5575] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506] | ||
| + | * HMDB : HMDB00283 | ||
| + | {{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}} | ||
| + | {{#set: common name=α-D-ribofuranose}} | ||
| + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}} | ||
| + | {{#set: molecular weight=150.131 }} | ||
| + | {{#set: common name=α D-ribose}} | ||
| + | {{#set: consumed by=RIBOKIN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-14904}} | ||
Latest revision as of 19:05, 21 March 2018
Contents
Metabolite CPD-10330
- smiles:
- C(C1(C(C(C(O1)O)O)O))O
- common name:
- α-D-ribofuranose
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
- molecular weight:
- 150.131
- Synonym(s):
- α D-ribose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
